C26H44O6 — CID 90674143
methyl (Z)-7-[(1R,2R,3R,5S)-2-[(E)-2-(5,5-dimethyl-2-pentyl-1,3-dioxan-2-yl)ethenyl]-3,5-dihydroxycyclopentyl]hept-5-enoate (PubChem CID 90674143) has the molecular formula C26H44O6 and a molecular weight of 452.63 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2R,3R,5S)-2-[(E)-2-(5,5-dimethyl-2-pentyl-1,3-dioxan-2-yl)ethenyl]-3,5-dihydroxycyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2R,3R,5S)-2-[(E)-2-(5,5-dimethyl-2-pentyl-1,3-dioxan-2-yl)ethenyl]-3,5-dihydroxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 90674143 |
| Molecular Formula | C26H44O6 |
| Molecular Weight | 452.63 g/mol |
| Exact Mass | 452.31 |
| IUPAC Name | methyl (Z)-7-[(1R,2R,3R,5S)-2-[(E)-2-(5,5-dimethyl-2-pentyl-1,3-dioxan-2-yl)ethenyl]-3,5-dihydroxycyclopentyl]hept-5-enoate |
| SMILES | CCCCCC1(/C=C/[C@@H]2[C@@H](C/C=C\CCCC(=O)OC)[C@@H](O)C[C@H]2O)OCC(C)(C)CO1 |
| InChI | InChI=1S/C26H44O6/c1-5-6-11-15-26(31-18-25(2,3)19-32-26)16-14-21-20(22(27)17-23(21)28)12-9-7-8-10-13-24(29)30-4/h7,9,14,16,20-23,27-28H,5-6,8,10-13,15,17-19H2,1-4H3/b9-7-,16-14+/t20-,21-,22+,23-/m1/s1 |
| InChIKey | PFFGZVFFKLBWOZ-RBVBEGIZSA-N |
| XLogP | 4.54 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.63 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|