C23H42O6 — CID 90674144
methyl (Z)-7-[(1R,2R,3R,5S)-2-(3,3-dimethoxyoctyl)-3,5-dihydroxycyclopentyl]hept-5-enoate (PubChem CID 90674144) has the molecular formula C23H42O6 and a molecular weight of 414.58 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2R,3R,5S)-2-(3,3-dimethoxyoctyl)-3,5-dihydroxycyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2R,3R,5S)-2-(3,3-dimethoxyoctyl)-3,5-dihydroxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 90674144 |
| Molecular Formula | C23H42O6 |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.30 |
| IUPAC Name | methyl (Z)-7-[(1R,2R,3R,5S)-2-(3,3-dimethoxyoctyl)-3,5-dihydroxycyclopentyl]hept-5-enoate |
| SMILES | CCCCCC(CC[C@@H]1[C@@H](C/C=C\CCCC(=O)OC)[C@@H](O)C[C@H]1O)(OC)OC |
| InChI | InChI=1S/C23H42O6/c1-5-6-11-15-23(28-3,29-4)16-14-19-18(20(24)17-21(19)25)12-9-7-8-10-13-22(26)27-2/h7,9,18-21,24-25H,5-6,8,10-17H2,1-4H3/b9-7-/t18-,19-,20+,21-/m1/s1 |
| InChIKey | MQXCYGPEFGBPLG-PCLKKHKQSA-N |
| XLogP | 3.98 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|