C11H16ClN2+ — CID 90674284
7-chloro-4,4-dimethyl-1,2,3,5-tetrahydro-1,4-benzodiazepin-4-ium (PubChem CID 90674284) has the molecular formula C11H16ClN2+ and a molecular weight of 211.72 g/mol. Its IUPAC name is 7-chloro-4,4-dimethyl-1,2,3,5-tetrahydro-1,4-benzodiazepin-4-ium.
| Compound Name | 7-chloro-4,4-dimethyl-1,2,3,5-tetrahydro-1,4-benzodiazepin-4-ium |
|---|---|
| PubChem CID | 90674284 |
| Molecular Formula | C11H16ClN2+ |
| Molecular Weight | 211.72 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 7-chloro-4,4-dimethyl-1,2,3,5-tetrahydro-1,4-benzodiazepin-4-ium |
| SMILES | C[N+]1(C)CCNc2ccc(Cl)cc2C1 |
| InChI | InChI=1S/C11H16ClN2/c1-14(2)6-5-13-11-4-3-10(12)7-9(11)8-14/h3-4,7,13H,5-6,8H2,1-2H3/q+1 |
| InChIKey | QVPWIWLACWDIQJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.72 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|