C22H36N4O3 — CID 90674643
(2R,3R,4R)-4-hydroxy-3-[(E,3R)-3-hydroxy-4,4-dimethyloct-1-enyl]-2-[(Z)-6-(2H-tetrazol-5-yl)hex-2-enyl]cyclopentan-1-one (PubChem CID 90674643) has the molecular formula C22H36N4O3 and a molecular weight of 404.56 g/mol. Its IUPAC name is (2R,3R,4R)-4-hydroxy-3-[(E,3R)-3-hydroxy-4,4-dimethyloct-1-enyl]-2-[(Z)-6-(2H-tetrazol-5-yl)hex-2-enyl]cyclopentan-1-one.
| Compound Name | (2R,3R,4R)-4-hydroxy-3-[(E,3R)-3-hydroxy-4,4-dimethyloct-1-enyl]-2-[(Z)-6-(2H-tetrazol-5-yl)hex-2-enyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 90674643 |
| Molecular Formula | C22H36N4O3 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | (2R,3R,4R)-4-hydroxy-3-[(E,3R)-3-hydroxy-4,4-dimethyloct-1-enyl]-2-[(Z)-6-(2H-tetrazol-5-yl)hex-2-enyl]cyclopentan-1-one |
| SMILES | CCCCC(C)(C)[C@H](O)/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1C/C=C\CCCc1nn[nH]n1 |
| InChI | InChI=1S/C22H36N4O3/c1-4-5-14-22(2,3)20(29)13-12-17-16(18(27)15-19(17)28)10-8-6-7-9-11-21-23-25-26-24-21/h6,8,12-13,16-17,19-20,28-29H,4-5,7,9-11,14-15H2,1-3H3,(H,23,24,25,26)/b8-6-,13-12+/t16-,17-,19-,20-/m1/s1 |
| InChIKey | AQWFDQHSXJTQCL-WMBBNPMCSA-N |
| XLogP | 3.17 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|