C8H12N2O5 — CID 90674754
1-[(2S,3R)-2,3,4-trihydroxybutyl]pyrimidine-2,4-dione (PubChem CID 90674754) has the molecular formula C8H12N2O5 and a molecular weight of 216.19 g/mol. Its IUPAC name is 1-[(2S,3R)-2,3,4-trihydroxybutyl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2S,3R)-2,3,4-trihydroxybutyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 90674754 |
| Molecular Formula | C8H12N2O5 |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 1-[(2S,3R)-2,3,4-trihydroxybutyl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn(C[C@H](O)[C@H](O)CO)c(=O)[nH]1 |
| InChI | InChI=1S/C8H12N2O5/c11-4-6(13)5(12)3-10-2-1-7(14)9-8(10)15/h1-2,5-6,11-13H,3-4H2,(H,9,14,15)/t5-,6+/m0/s1 |
| InChIKey | LDUAJYDZWKGQKY-NTSWFWBYSA-N |
| XLogP | -2.75 |
| TPSA | 115.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.19 |
| LogP ≤ 5 | -2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |