C22H28O2 — CID 90674763
(1S,2R,5S,6R,14R,15S,16S)-2-ethynyl-2-hydroxypentacyclo[14.3.1.01,5.06,15.09,14]icos-9-en-11-one (PubChem CID 90674763) has the molecular formula C22H28O2 and a molecular weight of 324.46 g/mol. Its IUPAC name is (1S,2R,5S,6R,14R,15S,16S)-2-ethynyl-2-hydroxypentacyclo[14.3.1.01,5.06,15.09,14]icos-9-en-11-one.
| Compound Name | (1S,2R,5S,6R,14R,15S,16S)-2-ethynyl-2-hydroxypentacyclo[14.3.1.01,5.06,15.09,14]icos-9-en-11-one |
|---|---|
| PubChem CID | 90674763 |
| Molecular Formula | C22H28O2 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | (1S,2R,5S,6R,14R,15S,16S)-2-ethynyl-2-hydroxypentacyclo[14.3.1.01,5.06,15.09,14]icos-9-en-11-one |
| SMILES | C#C[C@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@@H]4[C@H]3[C@H]3CCC[C@]21C3 |
| InChI | InChI=1S/C22H28O2/c1-2-22(24)11-9-19-18-7-5-14-12-16(23)6-8-17(14)20(18)15-4-3-10-21(19,22)13-15/h1,12,15,17-20,24H,3-11,13H2/t15-,17-,18-,19-,20+,21-,22-/m0/s1 |
| InChIKey | JININHMTTQSUHC-CDSHGXNMSA-N |
| XLogP | 3.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|