About 3-amino-2-methyl-1,1-diphenylpropan-2-ol;hydrochloride
3-amino-2-methyl-1,1-diphenylpropan-2-ol;hydrochloride (PubChem CID 90674805) has the molecular formula C16H20ClNO
and a molecular weight of 277.80 g/mol. Its IUPAC name is 3-amino-2-methyl-1,1-diphenylpropan-2-ol;hydrochloride.
Molecular Properties
| Compound Name | 3-amino-2-methyl-1,1-diphenylpropan-2-ol;hydrochloride |
| PubChem CID | 90674805 |
| Molecular Formula | C16H20ClNO |
| Molecular Weight | 277.80 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 3-amino-2-methyl-1,1-diphenylpropan-2-ol;hydrochloride |
| SMILES | CC(O)(CN)C(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C16H19NO.ClH/c1-16(18,12-17)15(13-8-4-2-5-9-13)14-10-6-3-7-11-14;/h2-11,15,18H,12,17H2,1H3;1H |
| InChIKey | VCYRPXXBAFHCRB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.80 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-amino-2-methyl-1,1-diphenylpropan-2-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-methyl-1,1-diphenylpropan-2-ol;hydrochloride?
The IUPAC name of 3-amino-2-methyl-1,1-diphenylpropan-2-ol;hydrochloride (CID 90674805) is 3-amino-2-methyl-1,1-diphenylpropan-2-ol;hydrochloride.
What is the SMILES notation for 3-amino-2-methyl-1,1-diphenylpropan-2-ol;hydrochloride?
The canonical SMILES for 3-amino-2-methyl-1,1-diphenylpropan-2-ol;hydrochloride is CC(O)(CN)C(c1ccccc1)c1ccccc1.Cl.
What is the InChIKey of 3-amino-2-methyl-1,1-diphenylpropan-2-ol;hydrochloride?
The InChIKey is VCYRPXXBAFHCRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO.ClH/c1-16(18,12-17)15(13-8-4-2-5-9-13)14-10-6-3-7-11-14;/h2-11,15,18H,12,17H2,1H3;1H.
What are the key properties of 3-amino-2-methyl-1,1-diphenylpropan-2-ol;hydrochloride?
3-amino-2-methyl-1,1-diphenylpropan-2-ol;hydrochloride has a molecular weight of 277.80 g/mol, XLogP of 2.95, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-methyl-1,1-diphenylpropan-2-ol;hydrochloride is sourced from PubChem (CID 90674805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).