About N'-[3-(1,3-dicyclohexylpropan-2-ylamino)propyl]propane-1,3-diamine;hydrochloride
N'-[3-(1,3-dicyclohexylpropan-2-ylamino)propyl]propane-1,3-diamine;hydrochloride (PubChem CID 90674828) has the molecular formula C21H44ClN3
and a molecular weight of 374.06 g/mol. Its IUPAC name is N'-[3-(1,3-dicyclohexylpropan-2-ylamino)propyl]propane-1,3-diamine;hydrochloride.
Molecular Properties
| Compound Name | N'-[3-(1,3-dicyclohexylpropan-2-ylamino)propyl]propane-1,3-diamine;hydrochloride |
| PubChem CID | 90674828 |
| Molecular Formula | C21H44ClN3 |
| Molecular Weight | 374.06 g/mol |
| Exact Mass | 373.32 |
| IUPAC Name | N'-[3-(1,3-dicyclohexylpropan-2-ylamino)propyl]propane-1,3-diamine;hydrochloride |
| SMILES | Cl.NCCCNCCCNC(CC1CCCCC1)CC1CCCCC1 |
| InChI | InChI=1S/C21H43N3.ClH/c22-13-7-14-23-15-8-16-24-21(17-19-9-3-1-4-10-19)18-20-11-5-2-6-12-20;/h19-21,23-24H,1-18,22H2;1H |
| InChIKey | SLWPUCZWFSFDFN-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.06 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-[3-(1,3-dicyclohexylpropan-2-ylamino)propyl]propane-1,3-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[3-(1,3-dicyclohexylpropan-2-ylamino)propyl]propane-1,3-diamine;hydrochloride?
The IUPAC name of N'-[3-(1,3-dicyclohexylpropan-2-ylamino)propyl]propane-1,3-diamine;hydrochloride (CID 90674828) is N'-[3-(1,3-dicyclohexylpropan-2-ylamino)propyl]propane-1,3-diamine;hydrochloride.
What is the SMILES notation for N'-[3-(1,3-dicyclohexylpropan-2-ylamino)propyl]propane-1,3-diamine;hydrochloride?
The canonical SMILES for N'-[3-(1,3-dicyclohexylpropan-2-ylamino)propyl]propane-1,3-diamine;hydrochloride is Cl.NCCCNCCCNC(CC1CCCCC1)CC1CCCCC1.
What is the InChIKey of N'-[3-(1,3-dicyclohexylpropan-2-ylamino)propyl]propane-1,3-diamine;hydrochloride?
The InChIKey is SLWPUCZWFSFDFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H43N3.ClH/c22-13-7-14-23-15-8-16-24-21(17-19-9-3-1-4-10-19)18-20-11-5-2-6-12-20;/h19-21,23-24H,1-18,22H2;1H.
What are the key properties of N'-[3-(1,3-dicyclohexylpropan-2-ylamino)propyl]propane-1,3-diamine;hydrochloride?
N'-[3-(1,3-dicyclohexylpropan-2-ylamino)propyl]propane-1,3-diamine;hydrochloride has a molecular weight of 374.06 g/mol, XLogP of 4.64, 12 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[3-(1,3-dicyclohexylpropan-2-ylamino)propyl]propane-1,3-diamine;hydrochloride is sourced from PubChem (CID 90674828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).