About N'-[3-[1,5-dicyclohexylpentan-3-yl(methyl)amino]propyl]propane-1,3-diamine;hydrochloride
N'-[3-[1,5-dicyclohexylpentan-3-yl(methyl)amino]propyl]propane-1,3-diamine;hydrochloride (PubChem CID 90674839) has the molecular formula C24H50ClN3
and a molecular weight of 416.14 g/mol. Its IUPAC name is N'-[3-[1,5-dicyclohexylpentan-3-yl(methyl)amino]propyl]propane-1,3-diamine;hydrochloride.
Molecular Properties
| Compound Name | N'-[3-[1,5-dicyclohexylpentan-3-yl(methyl)amino]propyl]propane-1,3-diamine;hydrochloride |
| PubChem CID | 90674839 |
| Molecular Formula | C24H50ClN3 |
| Molecular Weight | 416.14 g/mol |
| Exact Mass | 415.37 |
| IUPAC Name | N'-[3-[1,5-dicyclohexylpentan-3-yl(methyl)amino]propyl]propane-1,3-diamine;hydrochloride |
| SMILES | CN(CCCNCCCN)C(CCC1CCCCC1)CCC1CCCCC1.Cl |
| InChI | InChI=1S/C24H49N3.ClH/c1-27(21-9-20-26-19-8-18-25)24(16-14-22-10-4-2-5-11-22)17-15-23-12-6-3-7-13-23;/h22-24,26H,2-21,25H2,1H3;1H |
| InChIKey | MQXOBCLDKAINKM-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.14 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-[3-[1,5-dicyclohexylpentan-3-yl(methyl)amino]propyl]propane-1,3-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[3-[1,5-dicyclohexylpentan-3-yl(methyl)amino]propyl]propane-1,3-diamine;hydrochloride?
The IUPAC name of N'-[3-[1,5-dicyclohexylpentan-3-yl(methyl)amino]propyl]propane-1,3-diamine;hydrochloride (CID 90674839) is N'-[3-[1,5-dicyclohexylpentan-3-yl(methyl)amino]propyl]propane-1,3-diamine;hydrochloride.
What is the SMILES notation for N'-[3-[1,5-dicyclohexylpentan-3-yl(methyl)amino]propyl]propane-1,3-diamine;hydrochloride?
The canonical SMILES for N'-[3-[1,5-dicyclohexylpentan-3-yl(methyl)amino]propyl]propane-1,3-diamine;hydrochloride is CN(CCCNCCCN)C(CCC1CCCCC1)CCC1CCCCC1.Cl.
What is the InChIKey of N'-[3-[1,5-dicyclohexylpentan-3-yl(methyl)amino]propyl]propane-1,3-diamine;hydrochloride?
The InChIKey is MQXOBCLDKAINKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H49N3.ClH/c1-27(21-9-20-26-19-8-18-25)24(16-14-22-10-4-2-5-11-22)17-15-23-12-6-3-7-13-23;/h22-24,26H,2-21,25H2,1H3;1H.
What are the key properties of N'-[3-[1,5-dicyclohexylpentan-3-yl(methyl)amino]propyl]propane-1,3-diamine;hydrochloride?
N'-[3-[1,5-dicyclohexylpentan-3-yl(methyl)amino]propyl]propane-1,3-diamine;hydrochloride has a molecular weight of 416.14 g/mol, XLogP of 5.76, 14 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[3-[1,5-dicyclohexylpentan-3-yl(methyl)amino]propyl]propane-1,3-diamine;hydrochloride is sourced from PubChem (CID 90674839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).