About N'-[3-[1,7-di(cyclohex-3-en-1-yl)heptan-4-ylamino]propyl]propane-1,3-diamine;hydrochloride
N'-[3-[1,7-di(cyclohex-3-en-1-yl)heptan-4-ylamino]propyl]propane-1,3-diamine;hydrochloride (PubChem CID 90674841) has the molecular formula C25H48ClN3
and a molecular weight of 426.13 g/mol. Its IUPAC name is N'-[3-[1,7-di(cyclohex-3-en-1-yl)heptan-4-ylamino]propyl]propane-1,3-diamine;hydrochloride.
Molecular Properties
| Compound Name | N'-[3-[1,7-di(cyclohex-3-en-1-yl)heptan-4-ylamino]propyl]propane-1,3-diamine;hydrochloride |
| PubChem CID | 90674841 |
| Molecular Formula | C25H48ClN3 |
| Molecular Weight | 426.13 g/mol |
| Exact Mass | 425.35 |
| IUPAC Name | N'-[3-[1,7-di(cyclohex-3-en-1-yl)heptan-4-ylamino]propyl]propane-1,3-diamine;hydrochloride |
| SMILES | Cl.NCCCNCCCNC(CCCC1CC=CCC1)CCCC1CC=CCC1 |
| InChI | InChI=1S/C25H47N3.ClH/c26-19-9-20-27-21-10-22-28-25(17-7-15-23-11-3-1-4-12-23)18-8-16-24-13-5-2-6-14-24;/h1-3,5,23-25,27-28H,4,6-22,26H2;1H |
| InChIKey | GAOIZJITVNZOSH-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.13 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N'-[3-[1,7-di(cyclohex-3-en-1-yl)heptan-4-ylamino]propyl]propane-1,3-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[3-[1,7-di(cyclohex-3-en-1-yl)heptan-4-ylamino]propyl]propane-1,3-diamine;hydrochloride?
The IUPAC name of N'-[3-[1,7-di(cyclohex-3-en-1-yl)heptan-4-ylamino]propyl]propane-1,3-diamine;hydrochloride (CID 90674841) is N'-[3-[1,7-di(cyclohex-3-en-1-yl)heptan-4-ylamino]propyl]propane-1,3-diamine;hydrochloride.
What is the SMILES notation for N'-[3-[1,7-di(cyclohex-3-en-1-yl)heptan-4-ylamino]propyl]propane-1,3-diamine;hydrochloride?
The canonical SMILES for N'-[3-[1,7-di(cyclohex-3-en-1-yl)heptan-4-ylamino]propyl]propane-1,3-diamine;hydrochloride is Cl.NCCCNCCCNC(CCCC1CC=CCC1)CCCC1CC=CCC1.
What is the InChIKey of N'-[3-[1,7-di(cyclohex-3-en-1-yl)heptan-4-ylamino]propyl]propane-1,3-diamine;hydrochloride?
The InChIKey is GAOIZJITVNZOSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H47N3.ClH/c26-19-9-20-27-21-10-22-28-25(17-7-15-23-11-3-1-4-12-23)18-8-16-24-13-5-2-6-14-24;/h1-3,5,23-25,27-28H,4,6-22,26H2;1H.
What are the key properties of N'-[3-[1,7-di(cyclohex-3-en-1-yl)heptan-4-ylamino]propyl]propane-1,3-diamine;hydrochloride?
N'-[3-[1,7-di(cyclohex-3-en-1-yl)heptan-4-ylamino]propyl]propane-1,3-diamine;hydrochloride has a molecular weight of 426.13 g/mol, XLogP of 5.75, 16 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[3-[1,7-di(cyclohex-3-en-1-yl)heptan-4-ylamino]propyl]propane-1,3-diamine;hydrochloride is sourced from PubChem (CID 90674841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).