C20H19F4NO4 — CID 90675026
(Z)-but-2-enedioic acid;1-[2-(1,1,2,2-tetrafluoro-2-phenylethyl)phenyl]ethanamine (PubChem CID 90675026) has the molecular formula C20H19F4NO4 and a molecular weight of 413.37 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;1-[2-(1,1,2,2-tetrafluoro-2-phenylethyl)phenyl]ethanamine.
| Compound Name | (Z)-but-2-enedioic acid;1-[2-(1,1,2,2-tetrafluoro-2-phenylethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 90675026 |
| Molecular Formula | C20H19F4NO4 |
| Molecular Weight | 413.37 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | (Z)-but-2-enedioic acid;1-[2-(1,1,2,2-tetrafluoro-2-phenylethyl)phenyl]ethanamine |
| SMILES | CC(N)c1ccccc1C(F)(F)C(F)(F)c1ccccc1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C16H15F4N.C4H4O4/c1-11(21)13-9-5-6-10-14(13)16(19,20)15(17,18)12-7-3-2-4-8-12;5-3(6)1-2-4(7)8/h2-11H,21H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | VKHIQPKKPMYPJP-BTJKTKAUSA-N |
| XLogP | 4.30 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.37 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|