C16H16ClF4N — CID 90675033
2-[2-(1,1,2,2-tetrafluoro-2-phenylethyl)phenyl]ethanamine;hydrochloride (PubChem CID 90675033) has the molecular formula C16H16ClF4N and a molecular weight of 333.76 g/mol. Its IUPAC name is 2-[2-(1,1,2,2-tetrafluoro-2-phenylethyl)phenyl]ethanamine;hydrochloride.
| Compound Name | 2-[2-(1,1,2,2-tetrafluoro-2-phenylethyl)phenyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 90675033 |
| Molecular Formula | C16H16ClF4N |
| Molecular Weight | 333.76 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 2-[2-(1,1,2,2-tetrafluoro-2-phenylethyl)phenyl]ethanamine;hydrochloride |
| SMILES | Cl.NCCc1ccccc1C(F)(F)C(F)(F)c1ccccc1 |
| InChI | InChI=1S/C16H15F4N.ClH/c17-15(18,13-7-2-1-3-8-13)16(19,20)14-9-5-4-6-12(14)10-11-21;/h1-9H,10-11,21H2;1H |
| InChIKey | AUYUVWYFCYYEAP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.76 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|