C19H22ClF4N — CID 90675045
N,N-dimethyl-2-[4-(1,1,2,2-tetrafluoro-2-phenylethyl)phenyl]propan-2-amine;hydrochloride (PubChem CID 90675045) has the molecular formula C19H22ClF4N and a molecular weight of 375.84 g/mol. Its IUPAC name is N,N-dimethyl-2-[4-(1,1,2,2-tetrafluoro-2-phenylethyl)phenyl]propan-2-amine;hydrochloride.
| Compound Name | N,N-dimethyl-2-[4-(1,1,2,2-tetrafluoro-2-phenylethyl)phenyl]propan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 90675045 |
| Molecular Formula | C19H22ClF4N |
| Molecular Weight | 375.84 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | N,N-dimethyl-2-[4-(1,1,2,2-tetrafluoro-2-phenylethyl)phenyl]propan-2-amine;hydrochloride |
| SMILES | CN(C)C(C)(C)c1ccc(C(F)(F)C(F)(F)c2ccccc2)cc1.Cl |
| InChI | InChI=1S/C19H21F4N.ClH/c1-17(2,24(3)4)14-10-12-16(13-11-14)19(22,23)18(20,21)15-8-6-5-7-9-15;/h5-13H,1-4H3;1H |
| InChIKey | PSVKJZCQIRLQFY-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.84 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|