C18H20ClF4N — CID 90675046
2-[4-[1,1,2,2-tetrafluoro-2-(4-methylphenyl)ethyl]phenyl]propan-2-amine;hydrochloride (PubChem CID 90675046) has the molecular formula C18H20ClF4N and a molecular weight of 361.81 g/mol. Its IUPAC name is 2-[4-[1,1,2,2-tetrafluoro-2-(4-methylphenyl)ethyl]phenyl]propan-2-amine;hydrochloride.
| Compound Name | 2-[4-[1,1,2,2-tetrafluoro-2-(4-methylphenyl)ethyl]phenyl]propan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 90675046 |
| Molecular Formula | C18H20ClF4N |
| Molecular Weight | 361.81 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 2-[4-[1,1,2,2-tetrafluoro-2-(4-methylphenyl)ethyl]phenyl]propan-2-amine;hydrochloride |
| SMILES | Cc1ccc(C(F)(F)C(F)(F)c2ccc(C(C)(C)N)cc2)cc1.Cl |
| InChI | InChI=1S/C18H19F4N.ClH/c1-12-4-6-14(7-5-12)17(19,20)18(21,22)15-10-8-13(9-11-15)16(2,3)23;/h4-11H,23H2,1-3H3;1H |
| InChIKey | BAVSXTMZNNNXRM-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.81 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|