C27H27NO — CID 90675139
(1R,6R,8R)-6-phenyl-3-azapentacyclo[11.8.1.03,8.09,22.016,21]docosa-9,11,13(22),16,18,20-hexaen-6-ol (PubChem CID 90675139) has the molecular formula C27H27NO and a molecular weight of 381.52 g/mol. Its IUPAC name is (1R,6R,8R)-6-phenyl-3-azapentacyclo[11.8.1.03,8.09,22.016,21]docosa-9,11,13(22),16,18,20-hexaen-6-ol.
| Compound Name | (1R,6R,8R)-6-phenyl-3-azapentacyclo[11.8.1.03,8.09,22.016,21]docosa-9,11,13(22),16,18,20-hexaen-6-ol |
|---|---|
| PubChem CID | 90675139 |
| Molecular Formula | C27H27NO |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | (1R,6R,8R)-6-phenyl-3-azapentacyclo[11.8.1.03,8.09,22.016,21]docosa-9,11,13(22),16,18,20-hexaen-6-ol |
| SMILES | O[C@]1(c2ccccc2)CCN2C[C@@H]3c4ccccc4CCc4cccc(c43)[C@H]2C1 |
| InChI | InChI=1S/C27H27NO/c29-27(21-9-2-1-3-10-21)15-16-28-18-24-22-11-5-4-7-19(22)13-14-20-8-6-12-23(26(20)24)25(28)17-27/h1-12,24-25,29H,13-18H2/t24-,25-,27-/m1/s1 |
| InChIKey | XGYJKYWVFOUJAD-RGSZASNESA-N |
| XLogP | 4.96 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |