About 2-(4,5-dihydrobenzo[g][1,2]benzoxazol-7-yloxy)ethyl acetate;hydrochloride
2-(4,5-dihydrobenzo[g][1,2]benzoxazol-7-yloxy)ethyl acetate;hydrochloride (PubChem CID 90675202) has the molecular formula C15H16ClNO4
and a molecular weight of 309.75 g/mol. Its IUPAC name is 2-(4,5-dihydrobenzo[g][1,2]benzoxazol-7-yloxy)ethyl acetate;hydrochloride.
Molecular Properties
| Compound Name | 2-(4,5-dihydrobenzo[g][1,2]benzoxazol-7-yloxy)ethyl acetate;hydrochloride |
| PubChem CID | 90675202 |
| Molecular Formula | C15H16ClNO4 |
| Molecular Weight | 309.75 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 2-(4,5-dihydrobenzo[g][1,2]benzoxazol-7-yloxy)ethyl acetate;hydrochloride |
| SMILES | CC(=O)OCCOc1ccc2c(c1)CCc1cnoc1-2.Cl |
| InChI | InChI=1S/C15H15NO4.ClH/c1-10(17)18-6-7-19-13-4-5-14-11(8-13)2-3-12-9-16-20-15(12)14;/h4-5,8-9H,2-3,6-7H2,1H3;1H |
| InChIKey | BTCJUWXVZGDZFH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.75 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,5-dihydrobenzo[g][1,2]benzoxazol-7-yloxy)ethyl acetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dihydrobenzo[g][1,2]benzoxazol-7-yloxy)ethyl acetate;hydrochloride?
The IUPAC name of 2-(4,5-dihydrobenzo[g][1,2]benzoxazol-7-yloxy)ethyl acetate;hydrochloride (CID 90675202) is 2-(4,5-dihydrobenzo[g][1,2]benzoxazol-7-yloxy)ethyl acetate;hydrochloride.
What is the SMILES notation for 2-(4,5-dihydrobenzo[g][1,2]benzoxazol-7-yloxy)ethyl acetate;hydrochloride?
The canonical SMILES for 2-(4,5-dihydrobenzo[g][1,2]benzoxazol-7-yloxy)ethyl acetate;hydrochloride is CC(=O)OCCOc1ccc2c(c1)CCc1cnoc1-2.Cl.
What is the InChIKey of 2-(4,5-dihydrobenzo[g][1,2]benzoxazol-7-yloxy)ethyl acetate;hydrochloride?
The InChIKey is BTCJUWXVZGDZFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO4.ClH/c1-10(17)18-6-7-19-13-4-5-14-11(8-13)2-3-12-9-16-20-15(12)14;/h4-5,8-9H,2-3,6-7H2,1H3;1H.
What are the key properties of 2-(4,5-dihydrobenzo[g][1,2]benzoxazol-7-yloxy)ethyl acetate;hydrochloride?
2-(4,5-dihydrobenzo[g][1,2]benzoxazol-7-yloxy)ethyl acetate;hydrochloride has a molecular weight of 309.75 g/mol, XLogP of 2.80, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dihydrobenzo[g][1,2]benzoxazol-7-yloxy)ethyl acetate;hydrochloride is sourced from PubChem (CID 90675202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).