C19H20N2O — CID 90675552
4-[(1E,3E)-hepta-1,3-dienyl]-9-methoxypyrrolo[1,2-a]quinoxaline (PubChem CID 90675552) has the molecular formula C19H20N2O and a molecular weight of 292.38 g/mol. Its IUPAC name is 4-[(1E,3E)-hepta-1,3-dienyl]-9-methoxypyrrolo[1,2-a]quinoxaline.
| Compound Name | 4-[(1E,3E)-hepta-1,3-dienyl]-9-methoxypyrrolo[1,2-a]quinoxaline |
|---|---|
| PubChem CID | 90675552 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 4-[(1E,3E)-hepta-1,3-dienyl]-9-methoxypyrrolo[1,2-a]quinoxaline |
| SMILES | CCC/C=C/C=C/c1nc2cccc(OC)c2n2cccc12 |
| InChI | InChI=1S/C19H20N2O/c1-3-4-5-6-7-10-15-17-12-9-14-21(17)19-16(20-15)11-8-13-18(19)22-2/h5-14H,3-4H2,1-2H3/b6-5+,10-7+ |
| InChIKey | LVPQNVBJLNNCAJ-WEYXYWBQSA-N |
| XLogP | 4.87 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|