C20H22N2O — CID 90675556
9-methoxy-4-[(1E,3E)-octa-1,3-dienyl]pyrrolo[1,2-a]quinoxaline (PubChem CID 90675556) has the molecular formula C20H22N2O and a molecular weight of 306.41 g/mol. Its IUPAC name is 9-methoxy-4-[(1E,3E)-octa-1,3-dienyl]pyrrolo[1,2-a]quinoxaline.
| Compound Name | 9-methoxy-4-[(1E,3E)-octa-1,3-dienyl]pyrrolo[1,2-a]quinoxaline |
|---|---|
| PubChem CID | 90675556 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 9-methoxy-4-[(1E,3E)-octa-1,3-dienyl]pyrrolo[1,2-a]quinoxaline |
| SMILES | CCCC/C=C/C=C/c1nc2cccc(OC)c2n2cccc12 |
| InChI | InChI=1S/C20H22N2O/c1-3-4-5-6-7-8-11-16-18-13-10-15-22(18)20-17(21-16)12-9-14-19(20)23-2/h6-15H,3-5H2,1-2H3/b7-6+,11-8+ |
| InChIKey | CQCDHGJHRMLPNY-HRCSPUOPSA-N |
| XLogP | 5.26 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|