C18H18N2O — CID 90675558
3-ethoxy-4-[(1E,3E)-penta-1,3-dienyl]pyrrolo[1,2-a]quinoxaline (PubChem CID 90675558) has the molecular formula C18H18N2O and a molecular weight of 278.36 g/mol. Its IUPAC name is 3-ethoxy-4-[(1E,3E)-penta-1,3-dienyl]pyrrolo[1,2-a]quinoxaline.
| Compound Name | 3-ethoxy-4-[(1E,3E)-penta-1,3-dienyl]pyrrolo[1,2-a]quinoxaline |
|---|---|
| PubChem CID | 90675558 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 3-ethoxy-4-[(1E,3E)-penta-1,3-dienyl]pyrrolo[1,2-a]quinoxaline |
| SMILES | C/C=C/C=C/c1nc2ccccc2n2ccc(OCC)c12 |
| InChI | InChI=1S/C18H18N2O/c1-3-5-6-10-15-18-17(21-4-2)12-13-20(18)16-11-8-7-9-14(16)19-15/h3,5-13H,4H2,1-2H3/b5-3+,10-6+ |
| InChIKey | LTKMWKVLHSKXDG-YBRHCDHNSA-N |
| XLogP | 4.48 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|