C23H23NO2 — CID 90675882
(11R,12R,13R,14S)-13,15,15-trimethyl-12-phenyl-16-oxa-8-azatetracyclo[8.6.0.02,7.011,14]hexadeca-1(10),2,4,6-tetraen-9-one (PubChem CID 90675882) has the molecular formula C23H23NO2 and a molecular weight of 345.44 g/mol. Its IUPAC name is (11R,12R,13R,14S)-13,15,15-trimethyl-12-phenyl-16-oxa-8-azatetracyclo[8.6.0.02,7.011,14]hexadeca-1(10),2,4,6-tetraen-9-one.
| Compound Name | (11R,12R,13R,14S)-13,15,15-trimethyl-12-phenyl-16-oxa-8-azatetracyclo[8.6.0.02,7.011,14]hexadeca-1(10),2,4,6-tetraen-9-one |
|---|---|
| PubChem CID | 90675882 |
| Molecular Formula | C23H23NO2 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | (11R,12R,13R,14S)-13,15,15-trimethyl-12-phenyl-16-oxa-8-azatetracyclo[8.6.0.02,7.011,14]hexadeca-1(10),2,4,6-tetraen-9-one |
| SMILES | C[C@@H]1[C@@H](c2ccccc2)[C@H]2c3c(c4ccccc4[nH]c3=O)OC(C)(C)[C@@H]12 |
| InChI | InChI=1S/C23H23NO2/c1-13-17(14-9-5-4-6-10-14)18-19-21(26-23(2,3)20(13)18)15-11-7-8-12-16(15)24-22(19)25/h4-13,17-18,20H,1-3H3,(H,24,25)/t13-,17+,18+,20+/m1/s1 |
| InChIKey | YHGAEWTUAUUSBV-SBFOQGNTSA-N |
| XLogP | 4.83 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |