C27H32O4 — CID 90675893
methyl (1S,4aR,5S,8aR)-1,4a-dimethyl-5-[(2-methyl-5,8-dioxonaphthalen-1-yl)methyl]-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate (PubChem CID 90675893) has the molecular formula C27H32O4 and a molecular weight of 420.55 g/mol. Its IUPAC name is methyl (1S,4aR,5S,8aR)-1,4a-dimethyl-5-[(2-methyl-5,8-dioxonaphthalen-1-yl)methyl]-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate.
| Compound Name | methyl (1S,4aR,5S,8aR)-1,4a-dimethyl-5-[(2-methyl-5,8-dioxonaphthalen-1-yl)methyl]-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 90675893 |
| Molecular Formula | C27H32O4 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | methyl (1S,4aR,5S,8aR)-1,4a-dimethyl-5-[(2-methyl-5,8-dioxonaphthalen-1-yl)methyl]-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
| SMILES | C=C1CC[C@@H]2[C@](C)(CCC[C@]2(C)C(=O)OC)[C@H]1Cc1c(C)ccc2c1C(=O)C=CC2=O |
| InChI | InChI=1S/C27H32O4/c1-16-7-9-18-21(28)10-11-22(29)24(18)19(16)15-20-17(2)8-12-23-26(20,3)13-6-14-27(23,4)25(30)31-5/h7,9-11,20,23H,2,6,8,12-15H2,1,3-5H3/t20-,23+,26+,27-/m0/s1 |
| InChIKey | LNAHMPDYISECPW-CYDBCKOSSA-N |
| XLogP | 5.42 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|