C29H36Br4N4O4 — CID 90676108
(E)-3-(3,5-dibromo-4-methoxyphenyl)-N-[3-[3-[3-[[(E)-3-(3,5-dibromo-4-methoxyphenyl)prop-2-enoyl]amino]propylamino]propylamino]propyl]prop-2-enamide (PubChem CID 90676108) has the molecular formula C29H36Br4N4O4 and a molecular weight of 824.25 g/mol. Its IUPAC name is (E)-3-(3,5-dibromo-4-methoxyphenyl)-N-[3-[3-[3-[[(E)-3-(3,5-dibromo-4-methoxyphenyl)prop-2-enoyl]amino]propylamino]propylamino]propyl]prop-2-enamide.
| Compound Name | (E)-3-(3,5-dibromo-4-methoxyphenyl)-N-[3-[3-[3-[[(E)-3-(3,5-dibromo-4-methoxyphenyl)prop-2-enoyl]amino]propylamino]propylamino]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 90676108 |
| Molecular Formula | C29H36Br4N4O4 |
| Molecular Weight | 824.25 g/mol |
| Exact Mass | 819.95 |
| IUPAC Name | (E)-3-(3,5-dibromo-4-methoxyphenyl)-N-[3-[3-[3-[[(E)-3-(3,5-dibromo-4-methoxyphenyl)prop-2-enoyl]amino]propylamino]propylamino]propyl]prop-2-enamide |
| SMILES | COc1c(Br)cc(/C=C/C(=O)NCCCNCCCNCCCNC(=O)/C=C/c2cc(Br)c(OC)c(Br)c2)cc1Br |
| InChI | InChI=1S/C29H36Br4N4O4/c1-40-28-22(30)16-20(17-23(28)31)6-8-26(38)36-14-4-12-34-10-3-11-35-13-5-15-37-27(39)9-7-21-18-24(32)29(41-2)25(33)19-21/h6-9,16-19,34-35H,3-5,10-15H2,1-2H3,(H,36,38)(H,37,39)/b8-6+,9-7+ |
| InChIKey | MXXLTIIKJOFCPS-CDJQDVQCSA-N |
| XLogP | 6.06 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.25 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|