C20H18N6O2S — CID 90676122
5-amino-6-(5-nitro-2-phenyl-3-prop-2-enylindol-1-yl)-4,5-dihydro-2H-1,2,4-triazine-3-thione (PubChem CID 90676122) has the molecular formula C20H18N6O2S and a molecular weight of 406.47 g/mol. Its IUPAC name is 5-amino-6-(5-nitro-2-phenyl-3-prop-2-enylindol-1-yl)-4,5-dihydro-2H-1,2,4-triazine-3-thione.
| Compound Name | 5-amino-6-(5-nitro-2-phenyl-3-prop-2-enylindol-1-yl)-4,5-dihydro-2H-1,2,4-triazine-3-thione |
|---|---|
| PubChem CID | 90676122 |
| Molecular Formula | C20H18N6O2S |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 5-amino-6-(5-nitro-2-phenyl-3-prop-2-enylindol-1-yl)-4,5-dihydro-2H-1,2,4-triazine-3-thione |
| SMILES | C=CCc1c(-c2ccccc2)n(C2=NNC(=S)NC2N)c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C20H18N6O2S/c1-2-6-14-15-11-13(26(27)28)9-10-16(15)25(17(14)12-7-4-3-5-8-12)19-18(21)22-20(29)24-23-19/h2-5,7-11,18H,1,6,21H2,(H2,22,24,29) |
| InChIKey | IJJLCMWNPWVPEG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|