C17H15N7O4S2 — CID 90676132
1-(5-amino-3-sulfanylidene-4,5-dihydro-2H-1,2,4-triazin-6-yl)-5-nitro-2-phenylindole-3-sulfonamide (PubChem CID 90676132) has the molecular formula C17H15N7O4S2 and a molecular weight of 445.49 g/mol. Its IUPAC name is 1-(5-amino-3-sulfanylidene-4,5-dihydro-2H-1,2,4-triazin-6-yl)-5-nitro-2-phenylindole-3-sulfonamide.
| Compound Name | 1-(5-amino-3-sulfanylidene-4,5-dihydro-2H-1,2,4-triazin-6-yl)-5-nitro-2-phenylindole-3-sulfonamide |
|---|---|
| PubChem CID | 90676132 |
| Molecular Formula | C17H15N7O4S2 |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | 1-(5-amino-3-sulfanylidene-4,5-dihydro-2H-1,2,4-triazin-6-yl)-5-nitro-2-phenylindole-3-sulfonamide |
| SMILES | NC1NC(=S)NN=C1n1c(-c2ccccc2)c(S(N)(=O)=O)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C17H15N7O4S2/c18-15-16(21-22-17(29)20-15)23-12-7-6-10(24(25)26)8-11(12)14(30(19,27)28)13(23)9-4-2-1-3-5-9/h1-8,15H,18H2,(H2,19,27,28)(H2,20,22,29) |
| InChIKey | KPRRJAHMXDHGIT-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 170.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|