C24H42INO — CID 90676157
2-(2-adamantyloxy)ethyl-[(2E)-3,7-dimethylocta-2,6-dienyl]-dimethylazanium iodide (PubChem CID 90676157) has the molecular formula C24H42INO and a molecular weight of 487.51 g/mol. Its IUPAC name is 2-(2-adamantyloxy)ethyl-[(2E)-3,7-dimethylocta-2,6-dienyl]-dimethylazanium iodide.
| Compound Name | 2-(2-adamantyloxy)ethyl-[(2E)-3,7-dimethylocta-2,6-dienyl]-dimethylazanium iodide |
|---|---|
| PubChem CID | 90676157 |
| Molecular Formula | C24H42INO |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | 2-(2-adamantyloxy)ethyl-[(2E)-3,7-dimethylocta-2,6-dienyl]-dimethylazanium iodide |
| SMILES | CC(C)=CCC/C(C)=C/C[N+](C)(C)CCOC1C2CC3CC(C2)CC1C3.[I-] |
| InChI | InChI=1S/C24H42NO.HI/c1-18(2)7-6-8-19(3)9-10-25(4,5)11-12-26-24-22-14-20-13-21(16-22)17-23(24)15-20;/h7,9,20-24H,6,8,10-17H2,1-5H3;1H/q+1;/p-1/b19-9+; |
| InChIKey | SRUKBDOKZCWHSB-MYHMWQFYSA-M |
| XLogP | 2.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|