C19H33N3 — CID 90676180
(1S,4S,10R,12R)-9-hexyl-10-propyl-5,7-diazatricyclo[6.3.1.04,12]dodeca-5,8-dien-6-amine (PubChem CID 90676180) has the molecular formula C19H33N3 and a molecular weight of 303.49 g/mol. Its IUPAC name is (1S,4S,10R,12R)-9-hexyl-10-propyl-5,7-diazatricyclo[6.3.1.04,12]dodeca-5,8-dien-6-amine.
| Compound Name | (1S,4S,10R,12R)-9-hexyl-10-propyl-5,7-diazatricyclo[6.3.1.04,12]dodeca-5,8-dien-6-amine |
|---|---|
| PubChem CID | 90676180 |
| Molecular Formula | C19H33N3 |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.27 |
| IUPAC Name | (1S,4S,10R,12R)-9-hexyl-10-propyl-5,7-diazatricyclo[6.3.1.04,12]dodeca-5,8-dien-6-amine |
| SMILES | CCCCCCC1=C2NC(N)=N[C@H]3CC[C@@H](C[C@H]1CCC)[C@@H]23 |
| InChI | InChI=1S/C19H33N3/c1-3-5-6-7-9-15-13(8-4-2)12-14-10-11-16-17(14)18(15)22-19(20)21-16/h13-14,16-17H,3-12H2,1-2H3,(H3,20,21,22)/t13-,14+,16+,17-/m1/s1 |
| InChIKey | QXUSRABKFDDDPY-YQFWSFKMSA-N |
| XLogP | 4.34 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|