C20H31N3O — CID 90676377
N-(diaminomethylidene)-4-[(3-ethyl-2,4,4-trimethylcyclohexyl)methyl]benzamide (PubChem CID 90676377) has the molecular formula C20H31N3O and a molecular weight of 329.49 g/mol. Its IUPAC name is N-(diaminomethylidene)-4-[(3-ethyl-2,4,4-trimethylcyclohexyl)methyl]benzamide.
| Compound Name | N-(diaminomethylidene)-4-[(3-ethyl-2,4,4-trimethylcyclohexyl)methyl]benzamide |
|---|---|
| PubChem CID | 90676377 |
| Molecular Formula | C20H31N3O |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.25 |
| IUPAC Name | N-(diaminomethylidene)-4-[(3-ethyl-2,4,4-trimethylcyclohexyl)methyl]benzamide |
| SMILES | CCC1C(C)C(Cc2ccc(C(=O)N=C(N)N)cc2)CCC1(C)C |
| InChI | InChI=1S/C20H31N3O/c1-5-17-13(2)16(10-11-20(17,3)4)12-14-6-8-15(9-7-14)18(24)23-19(21)22/h6-9,13,16-17H,5,10-12H2,1-4H3,(H4,21,22,23,24) |
| InChIKey | YKHCAUNZHILION-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|