C25H38O3 — CID 90676470
[(1R,3aR,4S,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] 2-hydroxybenzoate (PubChem CID 90676470) has the molecular formula C25H38O3 and a molecular weight of 386.58 g/mol. Its IUPAC name is [(1R,3aR,4S,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] 2-hydroxybenzoate.
| Compound Name | [(1R,3aR,4S,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] 2-hydroxybenzoate |
|---|---|
| PubChem CID | 90676470 |
| Molecular Formula | C25H38O3 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | [(1R,3aR,4S,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] 2-hydroxybenzoate |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H](OC(=O)c3ccccc3O)CCC[C@]12C |
| InChI | InChI=1S/C25H38O3/c1-17(2)9-7-10-18(3)20-14-15-21-23(13-8-16-25(20,21)4)28-24(27)19-11-5-6-12-22(19)26/h5-6,11-12,17-18,20-21,23,26H,7-10,13-16H2,1-4H3/t18-,20-,21+,23+,25-/m1/s1 |
| InChIKey | QDTGUOKQCALDFM-UQXUXCPKSA-N |
| XLogP | 6.60 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |