C24H37NO2 — CID 90676473
[(1R,3aR,4S,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] pyridine-2-carboxylate (PubChem CID 90676473) has the molecular formula C24H37NO2 and a molecular weight of 371.57 g/mol. Its IUPAC name is [(1R,3aR,4S,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] pyridine-2-carboxylate.
| Compound Name | [(1R,3aR,4S,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] pyridine-2-carboxylate |
|---|---|
| PubChem CID | 90676473 |
| Molecular Formula | C24H37NO2 |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.28 |
| IUPAC Name | [(1R,3aR,4S,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] pyridine-2-carboxylate |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H](OC(=O)c3ccccn3)CCC[C@]12C |
| InChI | InChI=1S/C24H37NO2/c1-17(2)9-7-10-18(3)19-13-14-20-22(12-8-15-24(19,20)4)27-23(26)21-11-5-6-16-25-21/h5-6,11,16-20,22H,7-10,12-15H2,1-4H3/t18-,19-,20+,22+,24-/m1/s1 |
| InChIKey | FKVIDJSRPQEZTR-QOEYQVKJSA-N |
| XLogP | 6.29 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |