C25H23Cl2FN8O2 — CID 90676553
1-[(E)-(2,4-dichlorophenyl)methylideneamino]-3-[4-[[2-[4-[2-(dimethylamino)ethyl]-1,2,4-triazol-3-yl]-4-pyridinyl]oxy]-3-fluorophenyl]urea (PubChem CID 90676553) has the molecular formula C25H23Cl2FN8O2 and a molecular weight of 557.42 g/mol. Its IUPAC name is 1-[(E)-(2,4-dichlorophenyl)methylideneamino]-3-[4-[[2-[4-[2-(dimethylamino)ethyl]-1,2,4-triazol-3-yl]-4-pyridinyl]oxy]-3-fluorophenyl]urea.
| Compound Name | 1-[(E)-(2,4-dichlorophenyl)methylideneamino]-3-[4-[[2-[4-[2-(dimethylamino)ethyl]-1,2,4-triazol-3-yl]-4-pyridinyl]oxy]-3-fluorophenyl]urea |
|---|---|
| PubChem CID | 90676553 |
| Molecular Formula | C25H23Cl2FN8O2 |
| Molecular Weight | 557.42 g/mol |
| Exact Mass | 556.13 |
| IUPAC Name | 1-[(E)-(2,4-dichlorophenyl)methylideneamino]-3-[4-[[2-[4-[2-(dimethylamino)ethyl]-1,2,4-triazol-3-yl]-4-pyridinyl]oxy]-3-fluorophenyl]urea |
| SMILES | CN(C)CCn1cnnc1-c1cc(Oc2ccc(NC(=O)N/N=C/c3ccc(Cl)cc3Cl)cc2F)ccn1 |
| InChI | InChI=1S/C25H23Cl2FN8O2/c1-35(2)9-10-36-15-31-33-24(36)22-13-19(7-8-29-22)38-23-6-5-18(12-21(23)28)32-25(37)34-30-14-16-3-4-17(26)11-20(16)27/h3-8,11-15H,9-10H2,1-2H3,(H2,32,34,37)/b30-14+ |
| InChIKey | RXRDEPGMDFYQTQ-AMVVHIIESA-N |
| XLogP | 5.30 |
| TPSA | 109.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.42 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|