C25H25FN8O3 — CID 90676559
1-[4-[[2-[4-[2-(dimethylamino)ethyl]-1,2,4-triazol-3-yl]-4-pyridinyl]oxy]-3-fluorophenyl]-3-[(E)-(3-hydroxyphenyl)methylideneamino]urea (PubChem CID 90676559) has the molecular formula C25H25FN8O3 and a molecular weight of 504.53 g/mol. Its IUPAC name is 1-[4-[[2-[4-[2-(dimethylamino)ethyl]-1,2,4-triazol-3-yl]-4-pyridinyl]oxy]-3-fluorophenyl]-3-[(E)-(3-hydroxyphenyl)methylideneamino]urea.
| Compound Name | 1-[4-[[2-[4-[2-(dimethylamino)ethyl]-1,2,4-triazol-3-yl]-4-pyridinyl]oxy]-3-fluorophenyl]-3-[(E)-(3-hydroxyphenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 90676559 |
| Molecular Formula | C25H25FN8O3 |
| Molecular Weight | 504.53 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | 1-[4-[[2-[4-[2-(dimethylamino)ethyl]-1,2,4-triazol-3-yl]-4-pyridinyl]oxy]-3-fluorophenyl]-3-[(E)-(3-hydroxyphenyl)methylideneamino]urea |
| SMILES | CN(C)CCn1cnnc1-c1cc(Oc2ccc(NC(=O)N/N=C/c3cccc(O)c3)cc2F)ccn1 |
| InChI | InChI=1S/C25H25FN8O3/c1-33(2)10-11-34-16-29-31-24(34)22-14-20(8-9-27-22)37-23-7-6-18(13-21(23)26)30-25(36)32-28-15-17-4-3-5-19(35)12-17/h3-9,12-16,35H,10-11H2,1-2H3,(H2,30,32,36)/b28-15+ |
| InChIKey | BWHSUPMWUDTTPN-RWPZCVJISA-N |
| XLogP | 3.69 |
| TPSA | 129.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.53 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|