C26H31NO5 — CID 90676598
[(1R,2R,4aS,5R,8aS)-1-(hydroxymethyl)-1,4a-dimethyl-6-methylidene-5-[(2E)-2-(2-oxofuran-3-ylidene)ethyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-yl] pyridine-3-carboxylate (PubChem CID 90676598) has the molecular formula C26H31NO5 and a molecular weight of 437.54 g/mol. Its IUPAC name is [(1R,2R,4aS,5R,8aS)-1-(hydroxymethyl)-1,4a-dimethyl-6-methylidene-5-[(2E)-2-(2-oxofuran-3-ylidene)ethyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-yl] pyridine-3-carboxylate.
| Compound Name | [(1R,2R,4aS,5R,8aS)-1-(hydroxymethyl)-1,4a-dimethyl-6-methylidene-5-[(2E)-2-(2-oxofuran-3-ylidene)ethyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-yl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 90676598 |
| Molecular Formula | C26H31NO5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | [(1R,2R,4aS,5R,8aS)-1-(hydroxymethyl)-1,4a-dimethyl-6-methylidene-5-[(2E)-2-(2-oxofuran-3-ylidene)ethyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-yl] pyridine-3-carboxylate |
| SMILES | C=C1CC[C@@H]2[C@](C)(CO)[C@H](OC(=O)c3cccnc3)CC[C@@]2(C)[C@@H]1C/C=C1\C=COC1=O |
| InChI | InChI=1S/C26H31NO5/c1-17-6-9-21-25(2,20(17)8-7-18-11-14-31-23(18)29)12-10-22(26(21,3)16-28)32-24(30)19-5-4-13-27-15-19/h4-5,7,11,13-15,20-22,28H,1,6,8-10,12,16H2,2-3H3/b18-7+/t20-,21+,22-,25+,26+/m1/s1 |
| InChIKey | LFLNYPRESGEFRJ-UIGIUKKHSA-N |
| XLogP | 4.38 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|