C26H25FN8O4 — CID 90676630
1-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-[4-[[2-[4-[2-(dimethylamino)ethyl]-1,2,4-triazol-3-yl]-4-pyridinyl]oxy]-3-fluorophenyl]urea (PubChem CID 90676630) has the molecular formula C26H25FN8O4 and a molecular weight of 532.54 g/mol. Its IUPAC name is 1-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-[4-[[2-[4-[2-(dimethylamino)ethyl]-1,2,4-triazol-3-yl]-4-pyridinyl]oxy]-3-fluorophenyl]urea.
| Compound Name | 1-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-[4-[[2-[4-[2-(dimethylamino)ethyl]-1,2,4-triazol-3-yl]-4-pyridinyl]oxy]-3-fluorophenyl]urea |
|---|---|
| PubChem CID | 90676630 |
| Molecular Formula | C26H25FN8O4 |
| Molecular Weight | 532.54 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | 1-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-[4-[[2-[4-[2-(dimethylamino)ethyl]-1,2,4-triazol-3-yl]-4-pyridinyl]oxy]-3-fluorophenyl]urea |
| SMILES | CN(C)CCn1cnnc1-c1cc(Oc2ccc(NC(=O)N/N=C/c3ccc4c(c3)OCO4)cc2F)ccn1 |
| InChI | InChI=1S/C26H25FN8O4/c1-34(2)9-10-35-15-30-32-25(35)21-13-19(7-8-28-21)39-22-6-4-18(12-20(22)27)31-26(36)33-29-14-17-3-5-23-24(11-17)38-16-37-23/h3-8,11-15H,9-10,16H2,1-2H3,(H2,31,33,36)/b29-14+ |
| InChIKey | JUKOZSDIACGIFL-IPPBACCNSA-N |
| XLogP | 3.72 |
| TPSA | 128.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.54 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|