C21H33N3O — CID 90676711
4-[(5R,6R,9R,13S)-7-(pyridin-4-ylmethyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butan-1-ol (PubChem CID 90676711) has the molecular formula C21H33N3O and a molecular weight of 343.51 g/mol. Its IUPAC name is 4-[(5R,6R,9R,13S)-7-(pyridin-4-ylmethyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butan-1-ol.
| Compound Name | 4-[(5R,6R,9R,13S)-7-(pyridin-4-ylmethyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butan-1-ol |
|---|---|
| PubChem CID | 90676711 |
| Molecular Formula | C21H33N3O |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.26 |
| IUPAC Name | 4-[(5R,6R,9R,13S)-7-(pyridin-4-ylmethyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butan-1-ol |
| SMILES | OCCCC[C@@H]1[C@H]2CCCN3CCC[C@H](CN1Cc1ccncc1)[C@@H]23 |
| InChI | InChI=1S/C21H33N3O/c25-14-2-1-7-20-19-6-4-13-23-12-3-5-18(21(19)23)16-24(20)15-17-8-10-22-11-9-17/h8-11,18-21,25H,1-7,12-16H2/t18-,19-,20-,21+/m1/s1 |
| InChIKey | ZJOIQUCHDUBVKZ-NCYKPQTJSA-N |
| XLogP | 2.92 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|