About (2Z)-4,6-dihydroxy-2-[(4-phenylphenyl)methylidene]-1-benzofuran-3-one
(2Z)-4,6-dihydroxy-2-[(4-phenylphenyl)methylidene]-1-benzofuran-3-one (PubChem CID 90676895) has the molecular formula C21H14O4
and a molecular weight of 330.34 g/mol. Its IUPAC name is (2Z)-4,6-dihydroxy-2-[(4-phenylphenyl)methylidene]-1-benzofuran-3-one.
Molecular Properties
| Compound Name | (2Z)-4,6-dihydroxy-2-[(4-phenylphenyl)methylidene]-1-benzofuran-3-one |
| PubChem CID | 90676895 |
| Molecular Formula | C21H14O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | (2Z)-4,6-dihydroxy-2-[(4-phenylphenyl)methylidene]-1-benzofuran-3-one |
| SMILES | O=C1/C(=C/c2ccc(-c3ccccc3)cc2)Oc2cc(O)cc(O)c21 |
| InChI | InChI=1S/C21H14O4/c22-16-11-17(23)20-18(12-16)25-19(21(20)24)10-13-6-8-15(9-7-13)14-4-2-1-3-5-14/h1-12,22-23H/b19-10- |
| InChIKey | RSJKPGNQABXGLD-GRSHGNNSSA-N |
| XLogP | 4.38 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-4,6-dihydroxy-2-[(4-phenylphenyl)methylidene]-1-benzofuran-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-4,6-dihydroxy-2-[(4-phenylphenyl)methylidene]-1-benzofuran-3-one?
The IUPAC name of (2Z)-4,6-dihydroxy-2-[(4-phenylphenyl)methylidene]-1-benzofuran-3-one (CID 90676895) is (2Z)-4,6-dihydroxy-2-[(4-phenylphenyl)methylidene]-1-benzofuran-3-one.
What is the SMILES notation for (2Z)-4,6-dihydroxy-2-[(4-phenylphenyl)methylidene]-1-benzofuran-3-one?
The canonical SMILES for (2Z)-4,6-dihydroxy-2-[(4-phenylphenyl)methylidene]-1-benzofuran-3-one is O=C1/C(=C/c2ccc(-c3ccccc3)cc2)Oc2cc(O)cc(O)c21.
What is the InChIKey of (2Z)-4,6-dihydroxy-2-[(4-phenylphenyl)methylidene]-1-benzofuran-3-one?
The InChIKey is RSJKPGNQABXGLD-GRSHGNNSSA-N. The full InChI is InChI=1S/C21H14O4/c22-16-11-17(23)20-18(12-16)25-19(21(20)24)10-13-6-8-15(9-7-13)14-4-2-1-3-5-14/h1-12,22-23H/b19-10-.
What are the key properties of (2Z)-4,6-dihydroxy-2-[(4-phenylphenyl)methylidene]-1-benzofuran-3-one?
(2Z)-4,6-dihydroxy-2-[(4-phenylphenyl)methylidene]-1-benzofuran-3-one has a molecular weight of 330.34 g/mol, XLogP of 4.38, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-4,6-dihydroxy-2-[(4-phenylphenyl)methylidene]-1-benzofuran-3-one is sourced from PubChem (CID 90676895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).