C32H40N6O3 — CID 90676910
2-cyclopropyl-N-[2-[4-(2-methylphenyl)piperazin-1-yl]-5-[[3-(2-oxopyrrolidin-1-yl)propylamino]methyl]phenyl]-1,3-oxazole-4-carboxamide (PubChem CID 90676910) has the molecular formula C32H40N6O3 and a molecular weight of 556.71 g/mol. Its IUPAC name is 2-cyclopropyl-N-[2-[4-(2-methylphenyl)piperazin-1-yl]-5-[[3-(2-oxopyrrolidin-1-yl)propylamino]methyl]phenyl]-1,3-oxazole-4-carboxamide.
| Compound Name | 2-cyclopropyl-N-[2-[4-(2-methylphenyl)piperazin-1-yl]-5-[[3-(2-oxopyrrolidin-1-yl)propylamino]methyl]phenyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 90676910 |
| Molecular Formula | C32H40N6O3 |
| Molecular Weight | 556.71 g/mol |
| Exact Mass | 556.32 |
| IUPAC Name | 2-cyclopropyl-N-[2-[4-(2-methylphenyl)piperazin-1-yl]-5-[[3-(2-oxopyrrolidin-1-yl)propylamino]methyl]phenyl]-1,3-oxazole-4-carboxamide |
| SMILES | Cc1ccccc1N1CCN(c2ccc(CNCCCN3CCCC3=O)cc2NC(=O)c2coc(C3CC3)n2)CC1 |
| InChI | InChI=1S/C32H40N6O3/c1-23-6-2-3-7-28(23)36-16-18-37(19-17-36)29-12-9-24(21-33-13-5-15-38-14-4-8-30(38)39)20-26(29)34-31(40)27-22-41-32(35-27)25-10-11-25/h2-3,6-7,9,12,20,22,25,33H,4-5,8,10-11,13-19,21H2,1H3,(H,34,40) |
| InChIKey | HOFKLQRGJIWREF-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.71 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|