C22H24N2O5 — CID 90677056
(E)-N-[2-(2-oxo-1,3-dihydroindol-3-yl)ethyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 90677056) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is (E)-N-[2-(2-oxo-1,3-dihydroindol-3-yl)ethyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(2-oxo-1,3-dihydroindol-3-yl)ethyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 90677056 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | (E)-N-[2-(2-oxo-1,3-dihydroindol-3-yl)ethyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NCCC2C(=O)Nc3ccccc32)cc(OC)c1OC |
| InChI | InChI=1S/C22H24N2O5/c1-27-18-12-14(13-19(28-2)21(18)29-3)8-9-20(25)23-11-10-16-15-6-4-5-7-17(15)24-22(16)26/h4-9,12-13,16H,10-11H2,1-3H3,(H,23,25)(H,24,26)/b9-8+ |
| InChIKey | DKTLFKOUSHNMSS-CMDGGOBGSA-N |
| XLogP | 2.97 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|