About N-cyclohexyl-4-[2,4-di(propan-2-yl)phenyl]-2-imidazol-1-yl-4-oxobutanamide
N-cyclohexyl-4-[2,4-di(propan-2-yl)phenyl]-2-imidazol-1-yl-4-oxobutanamide (PubChem CID 90677133) has the molecular formula C25H35N3O2
and a molecular weight of 409.57 g/mol. Its IUPAC name is N-cyclohexyl-4-[2,4-di(propan-2-yl)phenyl]-2-imidazol-1-yl-4-oxobutanamide.
Molecular Properties
| Compound Name | N-cyclohexyl-4-[2,4-di(propan-2-yl)phenyl]-2-imidazol-1-yl-4-oxobutanamide |
| PubChem CID | 90677133 |
| Molecular Formula | C25H35N3O2 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.27 |
| IUPAC Name | N-cyclohexyl-4-[2,4-di(propan-2-yl)phenyl]-2-imidazol-1-yl-4-oxobutanamide |
| SMILES | CC(C)c1ccc(C(=O)CC(C(=O)NC2CCCCC2)n2ccnc2)c(C(C)C)c1 |
| InChI | InChI=1S/C25H35N3O2/c1-17(2)19-10-11-21(22(14-19)18(3)4)24(29)15-23(28-13-12-26-16-28)25(30)27-20-8-6-5-7-9-20/h10-14,16-18,20,23H,5-9,15H2,1-4H3,(H,27,30) |
| InChIKey | BQTOVSHIMVRGPL-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclohexyl-4-[2,4-di(propan-2-yl)phenyl]-2-imidazol-1-yl-4-oxobutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-4-[2,4-di(propan-2-yl)phenyl]-2-imidazol-1-yl-4-oxobutanamide?
The IUPAC name of N-cyclohexyl-4-[2,4-di(propan-2-yl)phenyl]-2-imidazol-1-yl-4-oxobutanamide (CID 90677133) is N-cyclohexyl-4-[2,4-di(propan-2-yl)phenyl]-2-imidazol-1-yl-4-oxobutanamide.
What is the SMILES notation for N-cyclohexyl-4-[2,4-di(propan-2-yl)phenyl]-2-imidazol-1-yl-4-oxobutanamide?
The canonical SMILES for N-cyclohexyl-4-[2,4-di(propan-2-yl)phenyl]-2-imidazol-1-yl-4-oxobutanamide is CC(C)c1ccc(C(=O)CC(C(=O)NC2CCCCC2)n2ccnc2)c(C(C)C)c1.
What is the InChIKey of N-cyclohexyl-4-[2,4-di(propan-2-yl)phenyl]-2-imidazol-1-yl-4-oxobutanamide?
The InChIKey is BQTOVSHIMVRGPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H35N3O2/c1-17(2)19-10-11-21(22(14-19)18(3)4)24(29)15-23(28-13-12-26-16-28)25(30)27-20-8-6-5-7-9-20/h10-14,16-18,20,23H,5-9,15H2,1-4H3,(H,27,30).
What are the key properties of N-cyclohexyl-4-[2,4-di(propan-2-yl)phenyl]-2-imidazol-1-yl-4-oxobutanamide?
N-cyclohexyl-4-[2,4-di(propan-2-yl)phenyl]-2-imidazol-1-yl-4-oxobutanamide has a molecular weight of 409.57 g/mol, XLogP of 5.39, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-4-[2,4-di(propan-2-yl)phenyl]-2-imidazol-1-yl-4-oxobutanamide is sourced from PubChem (CID 90677133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).