C14H12O4S — CID 90677221
4-(6-hydroxy-2,3-dihydro-1,4-benzoxathiin-2-yl)benzene-1,2-diol (PubChem CID 90677221) has the molecular formula C14H12O4S and a molecular weight of 276.31 g/mol. Its IUPAC name is 4-(6-hydroxy-2,3-dihydro-1,4-benzoxathiin-2-yl)benzene-1,2-diol.
| Compound Name | 4-(6-hydroxy-2,3-dihydro-1,4-benzoxathiin-2-yl)benzene-1,2-diol |
|---|---|
| PubChem CID | 90677221 |
| Molecular Formula | C14H12O4S |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 4-(6-hydroxy-2,3-dihydro-1,4-benzoxathiin-2-yl)benzene-1,2-diol |
| SMILES | Oc1ccc2c(c1)SCC(c1ccc(O)c(O)c1)O2 |
| InChI | InChI=1S/C14H12O4S/c15-9-2-4-12-14(6-9)19-7-13(18-12)8-1-3-10(16)11(17)5-8/h1-6,13,15-17H,7H2 |
| InChIKey | GALVITWPPNSLNC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|