C31H35FN2O4 — CID 90677249
5-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-2,2-dimethyl-6-propanoyl-10-propylpyrano[2,3-f]chromen-8-one (PubChem CID 90677249) has the molecular formula C31H35FN2O4 and a molecular weight of 518.63 g/mol. Its IUPAC name is 5-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-2,2-dimethyl-6-propanoyl-10-propylpyrano[2,3-f]chromen-8-one.
| Compound Name | 5-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-2,2-dimethyl-6-propanoyl-10-propylpyrano[2,3-f]chromen-8-one |
|---|---|
| PubChem CID | 90677249 |
| Molecular Formula | C31H35FN2O4 |
| Molecular Weight | 518.63 g/mol |
| Exact Mass | 518.26 |
| IUPAC Name | 5-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-2,2-dimethyl-6-propanoyl-10-propylpyrano[2,3-f]chromen-8-one |
| SMILES | CCCc1cc(=O)oc2c(C(=O)CC)c(N3CCN(Cc4ccc(F)cc4)CC3)c3c(c12)OC(C)(C)C=C3 |
| InChI | InChI=1S/C31H35FN2O4/c1-5-7-21-18-25(36)37-30-26(21)29-23(12-13-31(3,4)38-29)28(27(30)24(35)6-2)34-16-14-33(15-17-34)19-20-8-10-22(32)11-9-20/h8-13,18H,5-7,14-17,19H2,1-4H3 |
| InChIKey | SCRFTYRGNFWUJE-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.63 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|