C20H17NO6 — CID 90677299
10,10-dimethyl-4-nitro-5,11,21-trioxapentacyclo[11.8.0.02,6.07,12.014,19]henicosa-1(13),2(6),3,7(12),8,14(19)-hexaen-20-one (PubChem CID 90677299) has the molecular formula C20H17NO6 and a molecular weight of 367.36 g/mol. Its IUPAC name is 10,10-dimethyl-4-nitro-5,11,21-trioxapentacyclo[11.8.0.02,6.07,12.014,19]henicosa-1(13),2(6),3,7(12),8,14(19)-hexaen-20-one.
| Compound Name | 10,10-dimethyl-4-nitro-5,11,21-trioxapentacyclo[11.8.0.02,6.07,12.014,19]henicosa-1(13),2(6),3,7(12),8,14(19)-hexaen-20-one |
|---|---|
| PubChem CID | 90677299 |
| Molecular Formula | C20H17NO6 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 10,10-dimethyl-4-nitro-5,11,21-trioxapentacyclo[11.8.0.02,6.07,12.014,19]henicosa-1(13),2(6),3,7(12),8,14(19)-hexaen-20-one |
| SMILES | CC1(C)C=Cc2c(c3c4c(c(=O)oc3c3cc([N+](=O)[O-])oc23)CCCC4)O1 |
| InChI | InChI=1S/C20H17NO6/c1-20(2)8-7-12-16-13(9-14(25-16)21(23)24)17-15(18(12)27-20)10-5-3-4-6-11(10)19(22)26-17/h7-9H,3-6H2,1-2H3 |
| InChIKey | ZHCBQSTVHKLCKS-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 95.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|