About 3,3-dibenzyl-6-fluoro-4-hydroxy-1,4-dihydroquinolin-2-one
3,3-dibenzyl-6-fluoro-4-hydroxy-1,4-dihydroquinolin-2-one (PubChem CID 90677362) has the molecular formula C23H20FNO2
and a molecular weight of 361.42 g/mol. Its IUPAC name is 3,3-dibenzyl-6-fluoro-4-hydroxy-1,4-dihydroquinolin-2-one.
Molecular Properties
| Compound Name | 3,3-dibenzyl-6-fluoro-4-hydroxy-1,4-dihydroquinolin-2-one |
| PubChem CID | 90677362 |
| Molecular Formula | C23H20FNO2 |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 3,3-dibenzyl-6-fluoro-4-hydroxy-1,4-dihydroquinolin-2-one |
| SMILES | O=C1Nc2ccc(F)cc2C(O)C1(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C23H20FNO2/c24-18-11-12-20-19(13-18)21(26)23(22(27)25-20,14-16-7-3-1-4-8-16)15-17-9-5-2-6-10-17/h1-13,21,26H,14-15H2,(H,25,27) |
| InChIKey | GFIREDFCTVLONQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,3-dibenzyl-6-fluoro-4-hydroxy-1,4-dihydroquinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dibenzyl-6-fluoro-4-hydroxy-1,4-dihydroquinolin-2-one?
The IUPAC name of 3,3-dibenzyl-6-fluoro-4-hydroxy-1,4-dihydroquinolin-2-one (CID 90677362) is 3,3-dibenzyl-6-fluoro-4-hydroxy-1,4-dihydroquinolin-2-one.
What is the SMILES notation for 3,3-dibenzyl-6-fluoro-4-hydroxy-1,4-dihydroquinolin-2-one?
The canonical SMILES for 3,3-dibenzyl-6-fluoro-4-hydroxy-1,4-dihydroquinolin-2-one is O=C1Nc2ccc(F)cc2C(O)C1(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of 3,3-dibenzyl-6-fluoro-4-hydroxy-1,4-dihydroquinolin-2-one?
The InChIKey is GFIREDFCTVLONQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20FNO2/c24-18-11-12-20-19(13-18)21(26)23(22(27)25-20,14-16-7-3-1-4-8-16)15-17-9-5-2-6-10-17/h1-13,21,26H,14-15H2,(H,25,27).
What are the key properties of 3,3-dibenzyl-6-fluoro-4-hydroxy-1,4-dihydroquinolin-2-one?
3,3-dibenzyl-6-fluoro-4-hydroxy-1,4-dihydroquinolin-2-one has a molecular weight of 361.42 g/mol, XLogP of 4.28, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dibenzyl-6-fluoro-4-hydroxy-1,4-dihydroquinolin-2-one is sourced from PubChem (CID 90677362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).