About 6-chloro-3,3-bis[(4-chlorophenyl)methyl]-1-ethyl-4-hydroxy-4H-quinolin-2-one
6-chloro-3,3-bis[(4-chlorophenyl)methyl]-1-ethyl-4-hydroxy-4H-quinolin-2-one (PubChem CID 90677375) has the molecular formula C25H22Cl3NO2
and a molecular weight of 474.82 g/mol. Its IUPAC name is 6-chloro-3,3-bis[(4-chlorophenyl)methyl]-1-ethyl-4-hydroxy-4H-quinolin-2-one.
Molecular Properties
| Compound Name | 6-chloro-3,3-bis[(4-chlorophenyl)methyl]-1-ethyl-4-hydroxy-4H-quinolin-2-one |
| PubChem CID | 90677375 |
| Molecular Formula | C25H22Cl3NO2 |
| Molecular Weight | 474.82 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | 6-chloro-3,3-bis[(4-chlorophenyl)methyl]-1-ethyl-4-hydroxy-4H-quinolin-2-one |
| SMILES | CCN1C(=O)C(Cc2ccc(Cl)cc2)(Cc2ccc(Cl)cc2)C(O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C25H22Cl3NO2/c1-2-29-22-12-11-20(28)13-21(22)23(30)25(24(29)31,14-16-3-7-18(26)8-4-16)15-17-5-9-19(27)10-6-17/h3-13,23,30H,2,14-15H2,1H3 |
| InChIKey | ONWCDPSXLWBYBE-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 474.82 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-chloro-3,3-bis[(4-chlorophenyl)methyl]-1-ethyl-4-hydroxy-4H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3,3-bis[(4-chlorophenyl)methyl]-1-ethyl-4-hydroxy-4H-quinolin-2-one?
The IUPAC name of 6-chloro-3,3-bis[(4-chlorophenyl)methyl]-1-ethyl-4-hydroxy-4H-quinolin-2-one (CID 90677375) is 6-chloro-3,3-bis[(4-chlorophenyl)methyl]-1-ethyl-4-hydroxy-4H-quinolin-2-one.
What is the SMILES notation for 6-chloro-3,3-bis[(4-chlorophenyl)methyl]-1-ethyl-4-hydroxy-4H-quinolin-2-one?
The canonical SMILES for 6-chloro-3,3-bis[(4-chlorophenyl)methyl]-1-ethyl-4-hydroxy-4H-quinolin-2-one is CCN1C(=O)C(Cc2ccc(Cl)cc2)(Cc2ccc(Cl)cc2)C(O)c2cc(Cl)ccc21.
What is the InChIKey of 6-chloro-3,3-bis[(4-chlorophenyl)methyl]-1-ethyl-4-hydroxy-4H-quinolin-2-one?
The InChIKey is ONWCDPSXLWBYBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22Cl3NO2/c1-2-29-22-12-11-20(28)13-21(22)23(30)25(24(29)31,14-16-3-7-18(26)8-4-16)15-17-5-9-19(27)10-6-17/h3-13,23,30H,2,14-15H2,1H3.
What are the key properties of 6-chloro-3,3-bis[(4-chlorophenyl)methyl]-1-ethyl-4-hydroxy-4H-quinolin-2-one?
6-chloro-3,3-bis[(4-chlorophenyl)methyl]-1-ethyl-4-hydroxy-4H-quinolin-2-one has a molecular weight of 474.82 g/mol, XLogP of 6.52, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3,3-bis[(4-chlorophenyl)methyl]-1-ethyl-4-hydroxy-4H-quinolin-2-one is sourced from PubChem (CID 90677375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).