C21H24N6O2 — CID 90677386
N-[(E)-[4-[3-(4-propyltriazol-1-yl)propoxy]phenyl]methylideneamino]pyridine-4-carboxamide (PubChem CID 90677386) has the molecular formula C21H24N6O2 and a molecular weight of 392.46 g/mol. Its IUPAC name is N-[(E)-[4-[3-(4-propyltriazol-1-yl)propoxy]phenyl]methylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[(E)-[4-[3-(4-propyltriazol-1-yl)propoxy]phenyl]methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 90677386 |
| Molecular Formula | C21H24N6O2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | N-[(E)-[4-[3-(4-propyltriazol-1-yl)propoxy]phenyl]methylideneamino]pyridine-4-carboxamide |
| SMILES | CCCc1cn(CCCOc2ccc(/C=N/NC(=O)c3ccncc3)cc2)nn1 |
| InChI | InChI=1S/C21H24N6O2/c1-2-4-19-16-27(26-24-19)13-3-14-29-20-7-5-17(6-8-20)15-23-25-21(28)18-9-11-22-12-10-18/h5-12,15-16H,2-4,13-14H2,1H3,(H,25,28)/b23-15+ |
| InChIKey | ZRLVQFAVIHWCLU-HZHRSRAPSA-N |
| XLogP | 2.86 |
| TPSA | 94.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|