C15H19BrN2 — CID 90677416
2-[(4aS,9aS)-6-bromo-4-methylidene-2,3,9,9a-tetrahydro-1H-carbazol-4a-yl]ethanamine (PubChem CID 90677416) has the molecular formula C15H19BrN2 and a molecular weight of 307.24 g/mol. Its IUPAC name is 2-[(4aS,9aS)-6-bromo-4-methylidene-2,3,9,9a-tetrahydro-1H-carbazol-4a-yl]ethanamine.
| Compound Name | 2-[(4aS,9aS)-6-bromo-4-methylidene-2,3,9,9a-tetrahydro-1H-carbazol-4a-yl]ethanamine |
|---|---|
| PubChem CID | 90677416 |
| Molecular Formula | C15H19BrN2 |
| Molecular Weight | 307.24 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 2-[(4aS,9aS)-6-bromo-4-methylidene-2,3,9,9a-tetrahydro-1H-carbazol-4a-yl]ethanamine |
| SMILES | C=C1CCC[C@@H]2Nc3ccc(Br)cc3[C@]12CCN |
| InChI | InChI=1S/C15H19BrN2/c1-10-3-2-4-14-15(10,7-8-17)12-9-11(16)5-6-13(12)18-14/h5-6,9,14,18H,1-4,7-8,17H2/t14-,15-/m0/s1 |
| InChIKey | JWWQGYSYNUTYCF-GJZGRUSLSA-N |
| XLogP | 3.57 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.24 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|