C20H27BrN2O — CID 90677419
N-[2-[(4aS,9aS)-6-bromo-4-methylidene-2,3,9,9a-tetrahydro-1H-carbazol-4a-yl]ethyl]pentanamide (PubChem CID 90677419) has the molecular formula C20H27BrN2O and a molecular weight of 391.35 g/mol. Its IUPAC name is N-[2-[(4aS,9aS)-6-bromo-4-methylidene-2,3,9,9a-tetrahydro-1H-carbazol-4a-yl]ethyl]pentanamide.
| Compound Name | N-[2-[(4aS,9aS)-6-bromo-4-methylidene-2,3,9,9a-tetrahydro-1H-carbazol-4a-yl]ethyl]pentanamide |
|---|---|
| PubChem CID | 90677419 |
| Molecular Formula | C20H27BrN2O |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | N-[2-[(4aS,9aS)-6-bromo-4-methylidene-2,3,9,9a-tetrahydro-1H-carbazol-4a-yl]ethyl]pentanamide |
| SMILES | C=C1CCC[C@@H]2Nc3ccc(Br)cc3[C@]12CCNC(=O)CCCC |
| InChI | InChI=1S/C20H27BrN2O/c1-3-4-8-19(24)22-12-11-20-14(2)6-5-7-18(20)23-17-10-9-15(21)13-16(17)20/h9-10,13,18,23H,2-8,11-12H2,1H3,(H,22,24)/t18-,20-/m0/s1 |
| InChIKey | YTIRJLZAYGFVHN-ICSRJNTNSA-N |
| XLogP | 4.92 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|