C22H25N7O5 — CID 90677478
2-[2-[[5-(1,3-benzodioxol-5-ylmethyl)-1-[(4-methoxyphenyl)methyl]-4,6-dioxo-1,3,5-triazin-2-yl]amino]ethyl]guanidine (PubChem CID 90677478) has the molecular formula C22H25N7O5 and a molecular weight of 467.49 g/mol. Its IUPAC name is 2-[2-[[5-(1,3-benzodioxol-5-ylmethyl)-1-[(4-methoxyphenyl)methyl]-4,6-dioxo-1,3,5-triazin-2-yl]amino]ethyl]guanidine.
| Compound Name | 2-[2-[[5-(1,3-benzodioxol-5-ylmethyl)-1-[(4-methoxyphenyl)methyl]-4,6-dioxo-1,3,5-triazin-2-yl]amino]ethyl]guanidine |
|---|---|
| PubChem CID | 90677478 |
| Molecular Formula | C22H25N7O5 |
| Molecular Weight | 467.49 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 2-[2-[[5-(1,3-benzodioxol-5-ylmethyl)-1-[(4-methoxyphenyl)methyl]-4,6-dioxo-1,3,5-triazin-2-yl]amino]ethyl]guanidine |
| SMILES | COc1ccc(Cn2c(NCCN=C(N)N)nc(=O)n(Cc3ccc4c(c3)OCO4)c2=O)cc1 |
| InChI | InChI=1S/C22H25N7O5/c1-32-16-5-2-14(3-6-16)11-28-20(26-9-8-25-19(23)24)27-21(30)29(22(28)31)12-15-4-7-17-18(10-15)34-13-33-17/h2-7,10H,8-9,11-13H2,1H3,(H4,23,24,25)(H,26,27,30) |
| InChIKey | FJDHNMFPDVREPH-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 161.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.49 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|