C21H24IN7O3 — CID 90677479
2-[2-[[1-[(4-iodophenyl)methyl]-5-[(4-methoxyphenyl)methyl]-4,6-dioxo-1,3,5-triazin-2-yl]amino]ethyl]guanidine (PubChem CID 90677479) has the molecular formula C21H24IN7O3 and a molecular weight of 549.37 g/mol. Its IUPAC name is 2-[2-[[1-[(4-iodophenyl)methyl]-5-[(4-methoxyphenyl)methyl]-4,6-dioxo-1,3,5-triazin-2-yl]amino]ethyl]guanidine.
| Compound Name | 2-[2-[[1-[(4-iodophenyl)methyl]-5-[(4-methoxyphenyl)methyl]-4,6-dioxo-1,3,5-triazin-2-yl]amino]ethyl]guanidine |
|---|---|
| PubChem CID | 90677479 |
| Molecular Formula | C21H24IN7O3 |
| Molecular Weight | 549.37 g/mol |
| Exact Mass | 549.10 |
| IUPAC Name | 2-[2-[[1-[(4-iodophenyl)methyl]-5-[(4-methoxyphenyl)methyl]-4,6-dioxo-1,3,5-triazin-2-yl]amino]ethyl]guanidine |
| SMILES | COc1ccc(Cn2c(=O)nc(NCCN=C(N)N)n(Cc3ccc(I)cc3)c2=O)cc1 |
| InChI | InChI=1S/C21H24IN7O3/c1-32-17-8-4-15(5-9-17)13-29-20(30)27-19(26-11-10-25-18(23)24)28(21(29)31)12-14-2-6-16(22)7-3-14/h2-9H,10-13H2,1H3,(H4,23,24,25)(H,26,27,30) |
| InChIKey | XEYAHVMLUJTOGX-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 142.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.37 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|