About 2-amino-1-[(1E,7Z)-cycloocta-1,7-dien-1-yl]ethanol;hydrochloride
2-amino-1-[(1E,7Z)-cycloocta-1,7-dien-1-yl]ethanol;hydrochloride (PubChem CID 90677523) has the molecular formula C10H18ClNO
and a molecular weight of 203.71 g/mol. Its IUPAC name is 2-amino-1-[(1E,7Z)-cycloocta-1,7-dien-1-yl]ethanol;hydrochloride.
Molecular Properties
| Compound Name | 2-amino-1-[(1E,7Z)-cycloocta-1,7-dien-1-yl]ethanol;hydrochloride |
| PubChem CID | 90677523 |
| Molecular Formula | C10H18ClNO |
| Molecular Weight | 203.71 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 2-amino-1-[(1E,7Z)-cycloocta-1,7-dien-1-yl]ethanol;hydrochloride |
| SMILES | Cl.NCC(O)C1=C/CCCC/C=C\1 |
| InChI | InChI=1S/C10H17NO.ClH/c11-8-10(12)9-6-4-2-1-3-5-7-9;/h4,6-7,10,12H,1-3,5,8,11H2;1H/b6-4-,9-7+; |
| InChIKey | FCAWTQTZJFENMX-DZJVOSCXSA-N |
| XLogP | 1.78 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.71 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-amino-1-[(1E,7Z)-cycloocta-1,7-dien-1-yl]ethanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-[(1E,7Z)-cycloocta-1,7-dien-1-yl]ethanol;hydrochloride?
The IUPAC name of 2-amino-1-[(1E,7Z)-cycloocta-1,7-dien-1-yl]ethanol;hydrochloride (CID 90677523) is 2-amino-1-[(1E,7Z)-cycloocta-1,7-dien-1-yl]ethanol;hydrochloride.
What is the SMILES notation for 2-amino-1-[(1E,7Z)-cycloocta-1,7-dien-1-yl]ethanol;hydrochloride?
The canonical SMILES for 2-amino-1-[(1E,7Z)-cycloocta-1,7-dien-1-yl]ethanol;hydrochloride is Cl.NCC(O)C1=C/CCCC/C=C\1.
What is the InChIKey of 2-amino-1-[(1E,7Z)-cycloocta-1,7-dien-1-yl]ethanol;hydrochloride?
The InChIKey is FCAWTQTZJFENMX-DZJVOSCXSA-N. The full InChI is InChI=1S/C10H17NO.ClH/c11-8-10(12)9-6-4-2-1-3-5-7-9;/h4,6-7,10,12H,1-3,5,8,11H2;1H/b6-4-,9-7+;.
What are the key properties of 2-amino-1-[(1E,7Z)-cycloocta-1,7-dien-1-yl]ethanol;hydrochloride?
2-amino-1-[(1E,7Z)-cycloocta-1,7-dien-1-yl]ethanol;hydrochloride has a molecular weight of 203.71 g/mol, XLogP of 1.78, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-[(1E,7Z)-cycloocta-1,7-dien-1-yl]ethanol;hydrochloride is sourced from PubChem (CID 90677523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).