C18H22N2 — CID 90677526
(3S,5R)-N,N-dimethyl-1,5-diphenylpyrrolidin-3-amine (PubChem CID 90677526) has the molecular formula C18H22N2 and a molecular weight of 266.39 g/mol. Its IUPAC name is (3S,5R)-N,N-dimethyl-1,5-diphenylpyrrolidin-3-amine.
| Compound Name | (3S,5R)-N,N-dimethyl-1,5-diphenylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 90677526 |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | (3S,5R)-N,N-dimethyl-1,5-diphenylpyrrolidin-3-amine |
| SMILES | CN(C)[C@H]1C[C@H](c2ccccc2)N(c2ccccc2)C1 |
| InChI | InChI=1S/C18H22N2/c1-19(2)17-13-18(15-9-5-3-6-10-15)20(14-17)16-11-7-4-8-12-16/h3-12,17-18H,13-14H2,1-2H3/t17-,18+/m0/s1 |
| InChIKey | XSHXQKNIJVTSLI-ZWKOTPCHSA-N |
| XLogP | 3.57 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |